ChemNet > CAS > 23582-03-8 Tris[2-(difenilfosfin)etil]fosfin
23582-03-8 Tris[2-(difenilfosfin)etil]fosfin
| Ürün Adı |
Tris[2-(difenilfosfin)etil]fosfin |
| Eş anlamlı |
; Tris (2-difenilfosfinoetil) fosfin; TETRAFOS-II; (fosfantriiltrietan-2,1-diil)tris (difenilfosfan);
|
| ingilizce adı |
Tris[2-(diphenylphosphino)ethyl]phosphine; Tris(2-diphenylphosphinoethyl)phosphine; TETRAPHOS-II; (phosphanetriyltriethane-2,1-diyl)tris(diphenylphosphane) |
| Moleküler Formülü |
C42H42P4 |
| Molekül Ağırlığı |
670.6779 |
| InChI |
InChI=1/C42H42P4/c1-7-19-37(20-8-1)44(38-21-9-2-10-22-38)34-31-43(32-35-45(39-23-11-3-12-24-39)40-25-13-4-14-26-40)33-36-46(41-27-15-5-16-28-41)42-29-17-6-18-30-42/h1-30H,31-36H2 |
| CAS kayıt numarası |
23582-03-8 |
| EINECS |
245-754-3 |
| Moleküler Yapısı |
|
| Ergime noktası |
134-135℃ |
| Kaynama noktası |
740.1°C at 760 mmHg |
| Alevlenme noktası |
429.4°C |
| Buhar basıncı |
6.83E-21mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|